Diclofenac Sodium
Diclofenac Sodium (GP 45840) is a non-selective COX inhibitor with IC50 of 0.5 μg/ml and 0.5 μg/ml for COX-1 and -2 in intact cells, respectively, used as a nonsteroidal anti-inflammatory drug (NSAID) to relieve pain and reduce swelling in flammation.
| Trivial name | GP 45840 |
| Catalog Number | S1903 |
| Molecular Formula | C27H32F2N8.CH4O3S |
| CAS# | 15307-79-6 |
| Inchi | InChI=1S/C27H32F2N8.CH4O3S/c1-5-35-8-10-36(11-9-35)16-19-6-7-24(30-14-19)33-27-31-15-22(29)25(34-27)20-12-21(28)26-23(13-20)37(17(2)3)18(4)32-26;1-5(2,3)4/h6-7,12-15,17H,5,8-11,16H2,1-4H3,(H,30,31,33, 34);1H3,(H,2,3,4) |
| Inchi Key | NCJPFQPEVDHJAZ-UHFFFAOYSA-N |
| SMILES | CCN1CCN(CC1)CC2=CN=C(C=C2)NC3=NC=C(C(=N3)C4=CC5=C(C(=C4)F)N=C(N5C(C)C)C)F.CS(=O)(=O)O |
| Size | 10mM/1mL |
| Supplier Page | http://www.selleckchem.com/products/Diclofenac-sodium.html |
| Additional Information | https://file.selleck.cn/downloads/struct/diclofenac-chemical-structure-S1903.gif |
