LY 292728 | MedChemExpress (MCE)
LY 292728 is a potent leukotriene B4 (LTB4) receptor antagonist. LY 292728 binds to human neutrophils with a Ki of 0.47 nM and binds to guinea pig lung membranes with a Ki of 0.04 nM[1].
| Trivial name | LY 292728 |
| Catalog Number | HY-117706 |
| Research Area | Inflammation/Immunology |
| CAS# | 153034-77-6 |
| Purity | ≥98.00% |
| SMILES | O=C(O)C1=CC2=C(C=C1)OC3=C(C=CC(OCCCOC4=C(C=C(C(O)=C4)C5=CC=C(C=C5)F)CC)=C3CCC(O)=O)C2=O |
| PubChem Chemical Structure ID | 192617 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ly-292728.html |