LY 295427 | MedChemExpress (MCE)
LY 295427 is a LDL receptor modulator and a hypocholesterolemic agent. LY 295427 derepresses the transcription of the LDLR (LDL Receptor). LY 295427 can be used for hypercholesterolemia research[1][2][3].
| Trivial name | LY 295427 |
| Catalog Number | HY-125544 |
| Alternative Name(s) | Agisterol |
| Research Area | Metabolic Disease |
| CAS# | 152755-31-2 |
| Purity | ≥98.00% |
| SMILES | CC(CCC[C@H]([C@H]1CC[C@]2([C@@]3(CC[C@]4([C@@H]([C@@H](CC[C@@]4([C@]3(CC[C@]12C)[H])C)O)CC=C)[H])[H])[H])C)C |
| PubChem Chemical Structure ID | 9823927 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ly-295427.html |