Testosterone Isocaproate
API Standard
| Catalog Number | CS-O-02418 |
| Alternative Name(s) | 4-Androsten-17β-ol-3-one 17-(4-methylpentanoate), Testosterone 4-methylvalerate |
| Research Area | Therapeutic Testosterone is a synthetic form of the endogenous androgenic steroid testosterone. In vivo, testosterone is irreversibly converted to dihydrotestosterone (DHT) in target tissues by the enzyme 5-alpha reductase. Testosterone or DHT ligand-andr |
| Molecular Formula | C25H38O3 |
| CAS# | 15262-86-9 |
| Purity | >98% |
| SMILES | C[C@@](C(CC1)=CC2=O)(CC2)[C@]3([H])[C@]1([H])[C@@](CC[C@@H]4OC(CCC(C)C)=O)([H])[C@]4(C)CC3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02418.html |
