Epothilone B (EPO906) 10mM * 1mL in DMSO

Epothilone B is a macrolide that causes the formation of bundles of intracellular microtubules in non-mitotic cells, induces the formation of hyperstable tubulin polymers, and arrests cell cycling in mitosis.

Price Not Available 10mM * 1mL in DMSO Epothilone B (EPO906) 10mM * 1mL in DMSO Supplier Page
Trivial name Epothilone B (EPO906) 10mM * 1mL in DMSO
Catalog Number A10360-10mM-D
Alternative Name(s) (1S,3S,7S,10R,11S,12S,16R)-7,11-Dihydroxy-8,8,10,12,16- pentamethyl-3-[(1E)-1-methyl-2-(2-methyl-4-thiazolyl)et henyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione
Molecular Formula C27H41NO6S
CAS# 152044-54-7
SMILES C[C@H]1CCC[C@@]2([C@@H](O2)C[C@H](OC(=O)C[C@@H](C(C(=O)[C@@H]([C@H]1O)C)(C)C)O)/C(=C/C3=CSC(=N3)C)/C)C
Size 10mM * 1mL in DMSO
Supplier Page http://www.adooq.com/epothilone-b.html