Epothilone B 5mg
Epothilone B is a macrolide that causes the formation of bundles of intracellular microtubules in non-mitotic cells, induces the formation of hyperstable tubulin polymers, and arrests cell cycling in mitosis.
Trivial name | Epothilone B 5mg |
Catalog Number | A10360-5 |
Alternative Name(s) | (1S,3S,7S,10R,11S,12S,16R)-7,11-Dihydroxy-8,8,10,12,16- pentamethyl-3-[(1E)-1-methyl-2-(2-methyl-4-thiazolyl)et henyl]-4,17-dioxabicyclo[14.1.0]heptadecane-5,9-dione |
Molecular Formula | C27H41NO6S |
CAS# | 152044-54-7 |
SMILES | C[C@H]1CCC[C@@]2([C@@H](O2)C[C@H](OC(=O)C[C@@H](C(C(=O)[C@@H]([C@H]1O)C)(C)C)O)/C(=C/C3=CSC(=N3)C)/C)C |
Size | 5mg |
Supplier Page | http://www.adooq.com/epothilone-b.html |