N-Acetyldopamine dimmers A | MedChemExpress (MCE)
N-Acetyldopamine dimmers A (Compound (+)-2) can be isolated from the cast-off shell of the cicada of Cryptotympana sp. N-Acetyldopamine dimmers A increases collagen and α-SMA expression[1].
| Trivial name | N-Acetyldopamine dimmers A |
| Catalog Number | HY-N12703 |
| Research Area | Inflammation/Immunology |
| CAS# | 1519015-73-6 |
| Purity | ≥98.0% |
| SMILES | CC(N[C@H]1[C@H](C2=CC(O)=C(C=C2)O)OC3=CC(CCNC(C)=O)=CC=C3O1)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/n-acetyldopamine-dimmers-a.html |