Levomefolate Calcium
API Standard
| Catalog Number | CS-O-11676 |
| Alternative Name(s) | CALCIUML-5-METHYLTETRAHYDROFOLATE;(S)-2-(4-((((S)-2-Amino-5-methyl-4-oxo-3,4,5,6,7,8-hexahydropteridin-6-yl)methyl)amino)benzamido)pentanedioic acid, calcium salt |
| Research Area | The calcium salt of L-5-methyltetrahydrofolic acid which belongs to the group of folate vitamins (Vitamin B9, Folacin). It is a coenzymated form of folic acid and a more bioavailable alternative in dietary supplements. |
| Molecular Formula | C20H23CaN7O6 |
| CAS# | 151533-22-1 |
| Purity | >98% |
| SMILES | CN1C(CNC2=CC=C(C(NC(C([O-])=O)CCC([O-])=O)=O)C=C2)CNC3=C1C(N=C(N)N3)=O.[Ca+2] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11676.html |