Levomefolate Calcium 25mg
Levomefolic acid is the primary biologically active form of folic acid used at the cellular level for DNA reproduction, the cysteine cycle and the regulation of homocysteine.
| Trivial name | Levomefolate Calcium 25mg |
| Catalog Number | A13668-25 |
| Alternative Name(s) | N-[4-[[[(6S)-2-Amino-3,4,5,6,7,8-hexahydro-5-methyl-4-oxo-6-pteridinyl]methyl]amino]benzoyl]-L-glutamic Acid Calcium Salt |
| Molecular Formula | C20H25CaN7O6 |
| CAS# | 151533-22-1 |
| SMILES | CN1[C@H](CNC2=C1C(=O)N=C(N2)N)CNC3=CC=C(C=C3)C(=O)N[C@@H](CCC(=O)O)C(=O)O.[Ca+2] |
| Size | 25mg |
| Supplier Page | http://www.adooq.com/levomefolate-calcium.html |