Ramipril EP Impurity O
Impurities
| Trivial name | NULL |
| Catalog Number | CS-O-08090 |
| Alternative Name(s) | Ramipril EP Impurity O;(α1S,α4S,2S,5S)-2,5-Dimethyl-3,6-dioxo-α1,αDiethyl 2,2-(2,5-dimethyl-3,6-dioxopiperazine-1,4-diyl)bis(4-phenylbutanoate) ;4-bis(2-phenylethyl)-1,4-piperazine-[1(R*),2α,4(R*),5α]]-2,5-Dimethyl-3,6-dioxo-α,α-bis(2-phenylethyl)-1,4-piperazine |
| Research Area | it is an impurity of Ramipril, an antihypertensive agent that exerts inhibitory activities towards the angiotensin converting enzyme ;Impurity in commercial preparations of Ramipril |
| Molecular Formula | C30H38N2O6 |
| CAS# | 151387-05-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | O=C(OCC)[C@@H](N(C([C@H](C)N1[C@@H](CCC2=CC=CC=C2)C(OCC)=O)=O)[C@H](C1=O)C)CCC3=CC=CC=C3 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08090.html |
| Additional Information | NULL |