DIM-C-pPhOH
Nur77 (NR4A1) antagonist. Inhibits TGF-β induced cell migration of breast cancer cell lines. Promotes ROS/endoplasmic reticulum stress and proapoptotic pathways in pancreatic cancer cell lines. Mimics effects of Nur77 RNAi silencing.
| Catalog Number | T4400 |
| Alternative Name(s) | CDIM8 |
| Research Area | Apoptosis|||Others |
| Molecular Formula | C23H18N2O |
| CAS# | 151358-47-3 |
| Purity | 99.82% |
| SMILES | OC1=CC=C(C=C1)C(C1=CNC2=CC=CC=C12)C1=CNC2=C1C=CC=C2 |
| Size | 200 mg |
| Supplier Page | https://www.targetmol.com/compound/DIM-C-pPhOH |
| Additional Information | https://www.targetmol.com/datasheet/T4400 |
