KRN5500 | MedChemExpress (MCE)
KRN5500 (NSC 650426), a Spicamycin (HY-127130) derivative and a nucleoside-like antibiotic with anti-tumor activity. KRN5500 also induces apoptosis via the down-regulation of Bcl-2 expression. KRN5500 shows a significant efficacy in the human tumor xenograft model in mice[1][2].
| Trivial name | KRN5500 |
| Catalog Number | HY-13659 |
| Alternative Name(s) | NSC 650426 |
| Research Area | Infection; Cancer |
| CAS# | 151276-95-8 |
| Purity | ≥98.00% |
| SMILES | O[C@@H]1[C@H](O)[C@@H](NC(CNC(/C=C/C=C/CCCCCCCCC)=O)=O)[C@]([H])([C@@H](O)CO)O[C@@H]1NC2=NC=NC3=C2NC=N3 |
| PubChem Chemical Structure ID | 6440176 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/krn5500.html |