CL 316243 disodium salt 50mg
CL 316243 disodium salt, a beta-3 adrenergic agonist, was developed as an anti-obesity and diabetes drug, and causes rapid decreases in blood glucose levels in mice.
Trivial name | CL 316243 disodium salt 50mg |
Catalog Number | A13657-50 |
Alternative Name(s) | (R,R)-5-[2-[2-(3-Chlorophenyl)-2-hydroxyethylamino]propyl]-1,3-benzodioxole-2,2-dicarboxylic acid disodium salt |
Molecular Formula | C20H18ClNO7.2Na |
CAS# | 151126-84-0 |
SMILES | CC(CC1=CC2=C(C=C1)OC(O2)(C(=O)[O-])C(=O)[O-])NCC(C3=CC(=CC=C3)Cl)O.[Na+] |
Size | 50mg |
Supplier Page | http://www.adooq.com/cl-316243-disodium-salt.html |