Betamethasone Sodium Phosphate
Betamethasone Sodium Phosphate is the disodium salt of the 21-phosphate ester of betamethasone, a synthetic glucocorticoid with metabolic, immunosuppressive and anti-inflammatory actions. Betamethasone sodium phosphate binds to specific intracellular glucocorticoid receptors and subsequently binds to DNA to modify gene expression. The synthesis of certain anti-inflammatory proteins is induced while the synthesis of certain inflammatory mediators is inhibited. As a result, there is an overall reduction in chronic inflammation and autoimmune reactions.
Catalog Number | API151735 |
Alternative Name(s) | Bentelan Betamethasone 21-phosphate disodium salt Betamethasone disodium phosphate |
Research Area | APIs for Cortisones |
Molecular Formula | C22H28FNa2O8P |
CAS# | 151-73-5 |
SMILES | CC1CC2C3CCC4=CC(=O)C=CC4(C3(C(CC2(C1(C(=O)COP(=O)([O-])[O-])O)C)O)F)C.[Na+].[Na+] |
Size | inquiry |
Supplier Page | https://www.protheragen-ing.com/betamethasone-sodium-phosphate-item-6043.html |