Estriol 3-glucuronide sodium salt | MedChemExpress (MCE)
Estriol 3-glucuronide (Estriol 3-β-D-Glucuronide) sodium salt is a metabolite of Estriol. Estriol 3-glucuronide sodium salt competitively inhibits the hydrolysis of 4-methylumbelliferyl-β-D-glucuronide (4Mu-GlcU). Estriol 3-glucuronide sodium salt is a substrate for hydrolysis by Klotho-human IgG1 Fc protein (KLFc)[1].
| Trivial name | Estriol 3-glucuronide sodium salt |
| Catalog Number | HY-137321 |
| Alternative Name(s) | Estriol 3-β-D-Glucuronide sodium salt |
| Research Area | Metabolic Disease |
| CAS# | 15087-06-6 |
| Purity | ≥98.0% |
| SMILES | C[C@@]1([C@H]2O)[C@](C[C@H]2O)([H])[C@@](CCC3=C4)([H])[C@@](CC1)([H])C3=CC=C4O[C@@H]([C@@H]([C@H]5O)O)O[C@@H]([C@H]5O)C(O[Na])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/estriol-3-glucuronide-sodium-salt.html |