Oxybutynin HCl
Oxybutynin HCl a synthetic anticholinergic agent used for treatment of urinary incontinence and overactive bladder syndrome, with elimination half-life of 12.4–13.2 hours. Oxybutynin HCl is the HCl form of Oxybutynin.
| Trivial name | / |
| Catalog Number | CSN11636 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C22H32ClNO3 |
| CAS# | 1508-65-2 |
| Purity | ≥99% |
| SMILES | O=C(C(O)(C1=CC=CC=C1)C2CCCCC2)OCC#CCN(CC)CC.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/oxybutynin-hcl.html |
