Tolvaptan
API Standard
| Catalog Number | CS-O-31027 |
| Alternative Name(s) | N-(4-(7-chloro-5-hydroxy-2,3,4,5-tetrahydro-1H-benzo[b]azepine-1-carbonyl)-3-methylphenyl)-2-methylbenzamide |
| Research Area | It is a selective, competitive arginine vasopressin V2 receptor antagonist used to treat hyponatremia (low blood sodium levels) associated with congestive heart failure, cirrhosis, and the syndrome of inappropriate antidiuretic hormone (SIADH). |
| Molecular Formula | C26H25ClN2O3 |
| CAS# | 150683-30-0 |
| Purity | >98% |
| SMILES | O=C(C(C=CC(NC(C(C=CC=C1)=C1C)=O)=C2)=C2C)N3C4=CC=C(Cl)C=C4C(O)CCC3 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO31027.html |