2,3-Pentanedione-d3 | MedChemExpress (MCE)
2,3-Pentanedione-d3 is deuterated labeled Eugenol acetate (HY-W014612). Eugenol acetate (Eugenyl acetate) is an antibacterial, anticancer, anti-inflammatory and antioxidant. Eugenol acetate inhibits NF-κB and enhances the expression of p53 and p21 (WAF1). Eugenol acetate can prevent chemically induced skin cancer, inhibit cancer cell proliferation and induce apoptosis[1][2][3][4].
| Trivial name | 2,3-Pentanedione-d3 |
| Catalog Number | HY-W012998S2 |
| CAS# | 150678-00-5 |
| Purity | ≥98.0% |
| SMILES | CC(C(CC([2H])([2H])[2H])=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/2-3-pentanedione-d3.html |