Lactisole | MedChemExpress (MCE)
Lactisole is a canonical antagonist of sweet taste receptor, selectively targeting to T1R3 subunit, a glucose-sensing receptor. Lactisole inhibits insulin secretion induced by glucose in mouse islets[1][2].
| Trivial name | Lactisole |
| Catalog Number | HY-W030796A |
| Research Area | Metabolic Disease |
| CAS# | 150436-68-3 |
| Purity | 99.86% |
| SMILES | COC1=CC=C(C=C1)OC(C(O[Na])=O)C |
| PubChem Chemical Structure ID | 23670520 |
| Size | 10 mM * 1 mL |
| Supplier Page | https://www.medchemexpress.com/lactisole.html |