Prasugrel (Effient) 10mM * 1mL in DMSO
Prasugrel is a novel platelet inhibitor used for the reduction of thrombotic cardiovascular events (including stent thrombosis) in patients with acute coronary syndrome who are to be managed with PCI.
| Trivial name | Prasugrel (Effient) 10mM * 1mL in DMSO |
| Catalog Number | A10748-10mM-D |
| Alternative Name(s) | (RS)-5-[2-cyclopropyl-1-(2-fluorophenyl)-2-oxoethyl]-4,5,6,7-tetrahydrothieno [3,2-c]pyridin-2-yl acetate |
| Molecular Formula | C20H20FNO3S |
| CAS# | 150322-43-3 |
| SMILES | CC(=O)OC1=CC2=C(S1)CCN(C2)C(C3=CC=CC=C3F)C(=O)C4CC4 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/prasugrel-effient.html |