5-Carboxyfluorescein diacetate N-succinimidyl ester
5-Carboxyfluorescein diacetate N-succinimidyl ester is a cell permeable dye (Ex=492 nm, Em=517 nm). 5-Carboxyfluorescein diacetate N-succinimidyl ester can label cells by covalently binding to intracellular molecules. 5-Carboxyfluorescein diacetate N-succinimidyl ester is used to track lymphocyte migration and proliferation.
| Catalog Number | E7014 |
| Molecular Formula | C11H12N4O3S |
| CAS# | 150206-05-6 |
| Inchi | InChI=1S/C11H12N4O3S/c1-18-9-6-13-11(14-7-9)15-19(16,17)10-4-2-8(12)3-5-10/h2-7H,12H2,1H3,(H,13,14,15) |
| Inchi Key | GPTONYMQFTZPKC-UHFFFAOYSA-N |
| SMILES | COC1=CN=C(N=C1)NS(=O)(=O)C2=CC=C(C=C2)N |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/5-carboxyfluorescein-diacetate-n-succinimidyl-ester.html |
| Additional Information | https://file.selleck.cn/downloads/struct/e7014-5-carboxyfluorescein-diacetate-n-succinimidyl-ester-chemical-structure-tube.png |
