Azimilide 2HCl
Azimilide 2HCl, a class III antiarrhythmic compound, blocks the Kv7.1 and Kv11.1 patassium channels. It also inhibits Na+/Ca2+ exchanger in vitro.
| Trivial name | NE-10064 2HCl |
| Catalog Number | CSN17898 |
| Alternative Name(s) | NE-10064 2HCl |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C23H30Cl3N5O3 |
| CAS# | 149888-94-8 |
| Purity | ≥99% |
| SMILES | O=C1N(CCCCN2CCN(C)CC2)C(CN1/N=C/C3=CC=C(C4=CC=C(Cl)C=C4)O3)=O.[H]Cl.[H]Cl |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/azimilide-2hcl.html |