Clemastine Fumarate
API Standard
| Catalog Number | CS-O-06237 |
| Alternative Name(s) | (R)-2-(2-((R)-1-(4-chlorophenyl)-1-phenylethoxy)ethyl)-1-methylpyrrolidine fumarate |
| Research Area | For the relief of symptoms associated with allergic rhinitis such as sneezing, rhinorrhea, pruritus and acrimation. Also for the management of mild, uncomplicated allergic skin manifestations of urticaria and angioedema. Used as self-medication for temporary relief of symptoms associated with the common cold. |
| Molecular Formula | C25H30ClNO5 |
| CAS# | 14976-57-9 |
| Purity | >98% |
| SMILES | OC(/C=C/C(O)=O)=O.C[C@](C1=CC=C(Cl)C=C1)(C2=CC=CC=C2)OCC[C@@H](CCC3)N3C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO06237.html |