α-Conotoxin TxID | MedChemExpress (MCE)
α-Conotoxin TxID is a potent α3β4 nAChR antagonist with an IC50 value of 12.5 nM. α-Conotoxin TxID has weak inhibition activity of closely related α6/α3β4 nAChR (IC50= 94 nM). α-Conotoxin TxID has the potential for novel smoking cessation drug development[1].
| Trivial name | α-Conotoxin TxID |
| Catalog Number | HY-P5306 |
| Research Area | Neurological Disease |
| CAS# | 1496617-64-1 |
| Purity | ≥98.00% |
| SMILES | O=C([C@@H](NC([C@@H](NC([C@@](CSSC[C@H](NC([C@](NC([C@@](CCC1)([H])N1C2=O)=O)([H])[C@@H](C)CC)=O)C(N)=O)([H])NC3=O)=O)CO)=O)CC4=CN=CN4)N(CCC5)[C@]5([H])C(N[C@H](C(N[C@](CSSC[C@@H]3NC(CN)=O)([H])C(N[C@H](C(N[C@H](C(N[C@H](C(N[C@H]2CO)=O)CCSC)=O)C)=O)CO)=O)=O)C(C)C)=O |
| PubChem Chemical Structure ID | 72793396 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-conotoxin-txid.html |