Vorinostat (SAHA) 10mM * 1mL in DMSO
Vorinostat is an inhibitor of HDACs, inhibiting deacetylation and leading to an accumulation of both hyperacetylated histones and transcription factors.
| Trivial name | Vorinostat (SAHA) 10mM * 1mL in DMSO |
| Catalog Number | A10979-10mM-D |
| Alternative Name(s) | N-hydroxy-N'-phenyl-octanediamide |
| Molecular Formula | C14H20N2O3 |
| CAS# | 149647-78-9 |
| SMILES | C1=CC=C(C=C1)NC(=O)CCCCCCC(=O)NO |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/vorinostat-saha.html |