Marmin | MedChemExpress (MCE)
Marmin is a coumarin, that can be isolated from the immature bark of Aegle marmelos Correa. Marmin antagonizes the Histamine (HY-B1204)-induced contraction in competitive manner[1][2].
| Trivial name | Marmin |
| Catalog Number | HY-N3320 |
| Research Area | Neurological Disease |
| CAS# | 14957-38-1 |
| Purity | ≥98.00% |
| SMILES | CC(C)(O)[C@H](O)CC/C(C)=C/COC1=CC=C(C=CC2=O)C(O2)=C1 |
| PubChem Chemical Structure ID | 6450230 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/marmin.html |