Neuropeptide DF2 | MedChemExpress (MCE)
Neuropeptide DF2 is a DRNFLRFamide neuropeptide orignally isolated from crayfish. which enhances transmitter release and stimulates the amplitude of excitatory post-synaptic potentials (EPSP) through the calcium/calmodulin-dependent protein kinase[1].
| Trivial name | Neuropeptide DF2 |
| Catalog Number | HY-P1716 |
| Research Area | Neurological Disease |
| CAS# | 149471-11-4 |
| Purity | ≥98.0% |
| SMILES | O=C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC(N)=O)C(N[C@@H](CC1=CC=CC=C1)C(N[C@@H](CC(C)C)C(N[C@@H](CCCNC(N)=N)C(N[C@@H](CC2=CC=CC=C2)C(N)=O)=O)=O)=O)=O)=O)[C@H](CC(O)=O)N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/neuropeptide-df2.html |