1,2,3,4,6-Penta-O-Galloyl-beta-D-Glucopyranose
1,2,3,4,6-Penta-O-galloyl-β-D-glucopyranose, a natural product isolated and purified from the peel of Punica granatum L., suppresses interleukin (IL)-4 induced signal pathway in B cell, and inhibits IgE production partially caused by increasing a population of Treg cells in conjunction with Treg-inducing factors.
| Trivial name | Penta-O-Galloyl-β-D-Glucose; Penta-O-Galloyl-beta-D-Glucose; 1,2,3,4,6-Penta-O-Galloyl-β-D-Glucopyranose; Pentagalloylglucose |
| Catalog Number | CSN17074 |
| Alternative Name(s) | Penta-O-Galloyl-β-D-Glucose; Penta-O-Galloyl-beta-D-Glucose; 1,2,3,4,6-Penta-O-Galloyl-β-D-Glucopyranose; Pentagalloylglucose |
| Research Area | / |
| Molecular Formula | C41H32O26 |
| CAS# | 14937-32-7 |
| Purity | ≥98% |
| SMILES | O=C(C1=CC(O)=C(O)C(O)=C1)O[C@@H]([C@@H]([C@@H](COC(C2=CC(O)=C(O)C(O)=C2)=O)O3)OC(C4=CC(O)=C(O)C(O)=C4)=O)[C@H]([C@@H]3OC(C5=CC(O)=C(O)C(O)=C5)=O)OC(C6=CC(O)=C(O)C(O)=C6)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/1,2,3,4,6-penta-o-galloyl-beta-d-glucopyranose.html |