Brusatol
Brusatol is a plant-derived natural quassinoid that exhibits broad cytotoxicity in cancer cultures (IC50 < 1 μM against 457 cancer cell lines) by inhibiting de novo synthesis of cellular proteins (Effective conc. < 50 nM in A549 cells), including NRF2.
| Trivial name | / |
| Catalog Number | CSN13606 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C26H32O11 |
| CAS# | 14907-98-3 |
| Purity | ≥99% |
| SMILES | O=C([C@@]12[C@@H](O)[C@H](O)[C@@]([C@]3(C)[C@@](C(C)=C(O)C(C3)=O)([H])C[C@@]4([H])O5)([H])[C@]4(CO2)[C@@]1([H])[C@@H](OC(/C=C(C)/C)=O)C5=O)OC |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/brusatol.html |
