Ivabradine HCl
Ivabradine HCl (S 16257-2,S-18982 D6 hydrochloride), a new If inhibitor with IC 50 of 2.9 μM which acts specifically on the pacemaker activity of the sinoatrial node, is a pure heart rate lowering agent.
| Trivial name | S 16257-2,S-18982 D6 hydrochloride |
| Catalog Number | S2086 |
| Molecular Formula | C29H28ClN7OS |
| CAS# | 148849-67-6 |
| Inchi | InChI=1S/C29H28ClN7OS/c1-3-37-27-20(14-24(28(37)38)23-9-4-19(15-25(23)30)26-17-31-18-39-26)16-32-29(34-27)33-21-5-7-22(8-6-21)36-12-10-35(2)11-13-36/h4-9,14-18H,3,10-13H2,1-2H3,(H,32,33,34) |
| Inchi Key | DHUJCQOUWQMVCG-UHFFFAOYSA-N |
| SMILES | CCN1C2=NC(=NC=C2C=C(C1=O)C3=C(C=C(C=C3)C4=CN=CS4)Cl)NC5=CC=C(C=C5)N6CCN(CC6)C |
| Size | 10mg |
| Supplier Page | http://www.selleckchem.com/products/ivabradine-hcl-procoralan.html |
| Additional Information | https://file.selleck.cn/downloads/struct/ivabradine-hydrochloride-chemical-structure-s2086.gif |
