Ivabradine HCl
Ivabradine HCl is the first selective sinus node I(f) channel, used for the symptomatic management of stable heart-related chest pain and heart failure not fully managed by β blockers.
| Trivial name | S16257-2 |
| Catalog Number | CSN11239 |
| Alternative Name(s) | S16257-2 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C27H37ClN2O5 |
| CAS# | 148849-67-6 |
| Purity | ≥98% |
| SMILES | Cl[H].COC1=CC2=C(CC(=O)N(CCCN(C)C[C@H]3CC4=CC(OC)=C(OC)C=C34)CC2)C=C1OC |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/ivabradine-hcl.html |