Tyrphostin AG 879 10mM * 1mL in DMSO
Tyrphostin AG 879 is an inhibitor of the tyrosine kinase activity of nerve growth factor (NGF) TrkA.
| Trivial name | Tyrphostin AG 879 10mM * 1mL in DMSO |
| Catalog Number | A10053-10mM-D |
| Alternative Name(s) | (2E)-3-[3,5-Bis(1,1-dimethylethyl)-4-hydroxyphenyl]-2-cyano-2-propenethioamide |
| Molecular Formula | C18H24N2OS |
| CAS# | 148741-30-4 |
| SMILES | CC(C)(C)C1=CC(=C/C(=C(/N)S)/C#N)C=C(C1=O)C(C)(C)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tyrphostin-ag-879.html |
