L-732138
L-732138 (L-732,138) is a selective, potent and competitive antagonist of neurokinin-1 (NK-1) receptor/substance P (SP) receptor. L-732138 inhibits the binding of 125I-SP to the human NK-1 receptor stably expressed in CHO cells with IC50 of 2.3 nM.
| Trivial name | L-732,138 |
| Catalog Number | S0772 |
| Molecular Formula | C22H18F6N2O3 |
| CAS# | 148451-96-1 |
| SMILES | CC(=O)NC(CC1=CNC2=CC=CC=C21)C(=O)OCC3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/l-732138.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s0772-l-732138-chemical-structure.gif |