Thiabendazole (Standard) | MedChemExpress (MCE)
Thiabendazole (Standard) is the analytical standard of Thiabendazole. This product is intended for research and analytical applications. Thiabendazole inhibits worm-specific fumarate reductase and has anthelmintic properties.
| Trivial name | Thiabendazole (Standard) |
| Catalog Number | HY-B0263R |
| Alternative Name(s) | Tiabendazole (Standard); 2-(4-Thiazolyl)benzimidazole (Standard) |
| Research Area | Infection |
| CAS# | 148-79-8 |
| Purity | ≥98.0% |
| SMILES | C1(C2=CSC=N2)=NC3=CC=CC=C3N1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/thiabendazole-standard.html |