Citric Acid-2,2,4,4 D4
Deuterated Solvents and Reagents
| Trivial name | NULL |
| Catalog Number | CS-O-03111 |
| Alternative Name(s) | Citric Acid-2,2,4,4-D4;2-Hydroxy-1,2,3-propHydroxypropan-d4-1,2,3-tricarboxylic Acid; Citro-d4; E 330-d4; 3-Carboxy-3-hydroxypentane-d4-1,5-dioic Acid; Aciletten-d4; Celenex 3P6-d4; |
| Research Area | Widely distributed in plants and in animal tissues and fluids. Produced by mycological fermentation on an industrial scale using crude sugar solutions, such as molasses and strains of Aspergillus niger.;Labeled Citric Acid, intended for use as an internal standard for the quantification of Citric Acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H4D4O7 |
| CAS# | 147664-83-3 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(C([2H])([2H])C(O)=O)(C(O)=O)C([2H])([2H])C(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO03111.html |
| Additional Information | NULL |
