Pitavastatin calcium 10mM * 1mL in DMSO
Pitavastatin Calcium is a competitive inhibitor of the enzyme HMGCR (HMG-CoA reductase) results in a reduction in LDL cholesterol synthesis.
Trivial name | Pitavastatin calcium 10mM * 1mL in DMSO |
Catalog Number | A10737-10mM-D |
Alternative Name(s) | (+)-Monocalcium bis{(3R,5S,6E)-7-[2-cyclopropyl-4-(4-fluorophenyl)-3-quinolyl]-3,5-dihydroxy-6-heptenoate} |
Molecular Formula | (C25H23FNO4)2.Ca |
CAS# | 147526-32-7 |
SMILES | C1C(C1)C2=NC3=CC=CC=C3C(=C2/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C4=CC=C(C=C4)F.C1C(C1)C2=NC3=CC=CC=C3C(=C2/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C4=CC=C(C=C4)F.[Ca+2] |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/pitavastatin-calcium-livalo.html |