Pitavastatin
Pitavastatin is a potent HMG-CoA reductase inhibitor and inhibits cholesterol synthesis from acetic acid with an IC50 of 5.8 nM in a human liver cancer cell line (HepG2).
| Trivial name | NK-104 |
| Catalog Number | CSN11236 |
| Alternative Name(s) | NK-104 |
| Research Area | Cancer |
| Molecular Formula | C25H24FNO4 |
| CAS# | 147511-69-1 |
| Purity | ≥98% |
| SMILES | O=C(O)C[C@H](O)C[C@H](O)/C=C/C1=C(C2=CC=C(F)C=C2)C3=CC=CC=C3N=C1C4CC4 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/pitavastatin.html |