(S)-Tenofovir
One isomer impurity of Tenofovir, which is an acyclic phosphonate nucleotide derivative, could be used to treat HIV and chronic Hepatitis B (HBV) as a reverse transcriptase inhibitor.
| Trivial name | (S)-GS 1278; (S)-PMPA; (S)-TDF |
| Catalog Number | CSN25464 |
| Alternative Name(s) | (S)-GS 1278; (S)-PMPA; (S)-TDF |
| Research Area | Infection |
| Molecular Formula | C9H14N5O4P |
| CAS# | 147127-19-3 |
| Purity | ≥95% |
| SMILES | C[C@H](OCP(O)(O)=O)CN1C=NC2=C(N)N=CN=C12 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/(s)-(((1-(6-amino-9h-purin-9-yl)propan-2-yl)oxy)methyl)phosphonic-acid.html |