Rosuvastatin calcium 10mM * 1mL in DMSO
Rosuvastatin (Crestor) is a member of the drug class of statins, used to treat high cholesterol and related conditions, and to prevent cardiovascular disease. Rosuvastatin is a competitive inhibitor of the enzyme HMG-CoA reductase, having a mechanism of action similar to that of other statins.
| Trivial name | Rosuvastatin calcium 10mM * 1mL in DMSO |
| Catalog Number | A10810-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C22H28FN3O6S.1/2Ca |
| CAS# | 147098-20-2 |
| SMILES | CC(C1=NC(=NC(=C1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C2=CC=C(C=C2)F)N(S(=O)(=O)C)C)C.CC(C1=NC(=NC(=C1/C=C/[C@@H](O)C[C@@H](O)CC(=O)[O-])C2=CC=C(C=C2)F)N(S(=O)(=O)C)C)C.[Ca+2] |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/rosuvastatin-calcium-crestor.html |
