Diphenhydramine hcl 10mM * 1mL in DMSO
Diphenhydramine is a first-generation antihistamine possessing anticholinergic, antitussive, antiemetic and sedative properties which is mainly used to treat allergies.
Trivial name | Diphenhydramine hcl 10mM * 1mL in DMSO |
Catalog Number | A10318-10mM-D |
Alternative Name(s) | 2-Diphenylmethoxy-N,N-dimethylethylamine hydrochloride |
Molecular Formula | C17H21NO.HCl |
CAS# | 147-24-0 |
SMILES | CN(C)CCOC(C1=CC=CC=C1)C2=CC=CC=C2.Cl |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/diphenhydramine-hcl.html |