Atglistatin 10mg
Atglistatin is a highly potent, selective and competitive inhibitor of adipose triglyceride lipase (ATGL) with an IC50 of ~0.7 ??M for inhibition of lipolysis in vitro, but no toxicity up to a concentration of 50 ??M.
| Trivial name | Atglistatin 10mg |
| Catalog Number | A13814-10 |
| Alternative Name(s) | 3-(4'-(dimethylamino)-[1,1'-biphenyl]-3-yl)-1,1-dimethylurea |
| Molecular Formula | C17H21N3O |
| CAS# | 1469924-27-3 |
| SMILES | CN(C)C1=CC=C(C=C1)C2=CC(=CC=C2)NC(=O)N(C)C |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/atglistatin.html |
