Tris(triphenylphosphine)rhodium(I) Chloride
Fine Chemical
| Trivial name | NULL |
| Catalog Number | CS-T-45911 |
| Alternative Name(s) | Chlorotris(triphenylphosphine)rhodium |
| Research Area | Tris(triphenylphosphine)rhodium Chloride is also known as Wilkinson's catalyst and is commonly used to catalyze the hydrogenation of alkenes. Tris(triphenylphosphine)rhodium(I) Chloride is also used in the catalytic hydroboration of alkenes with catecholborane and pinacolborane and the selective 1,4-reduction of a, ß-unsaturated carbonyl compounds. |
| Molecular Formula | C54H45ClP3Rh |
| CAS# | 14694-95-2 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | [Cl-][Rh+]([P](C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)([P](C4=CC=CC=C4)(C5=CC=CC=C5)C6=CC=CC=C6)[P](C7=CC=CC=C7)(C8=CC=CC=C8)C9=CC=CC=C9 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST45911.html |
| Additional Information | NULL |