4-Amino-tempo | MedChemExpress (MCE)
4-Amino-TEMPO can be used as a spin label for detecting radicals and the damage caused by them. 4-Amino-TEMPO possesses superoxide dismutase-mimetic activity, enabling it to easily penetrate cells and protect them from oxidative damage induced by H2O2. Additionally, 4-Amino-TEMPO exhibits significant radiation protective properties, effectively safeguarding DNA from oxidative stress-induced damage caused by UV exposure due to its ability to maintain a positive charge. Furthermore, 4-Amino-TEMPO is a highly selective oxidation catalyst widely used in the research and development of various specialty chemicals, including fragrances, pesticides, and others [1].
| Trivial name | 4-Amino-tempo |
| Catalog Number | HY-W002004 |
| Alternative Name(s) | 4-Amino-2,2,6,6-tetramethylpiperidine-1-oxyl |
| Research Area | Others |
| CAS# | 14691-88-4 |
| Purity | ≥98.0% |
| SMILES | CC1(C)N([O])C(C)(C)CC(N)C1 |
| Size | 10 g |
| Supplier Page | https://www.medchemexpress.com/4-amino-tempo.html |
