Dantrolene Sodium
API Standard
| Catalog Number | CS-N-00354 |
| Alternative Name(s) | 1-[[5-(p-Nitrophenyl)furfurylidene]amino]hydantoin sodium; 1-[[5-(p-Nitrophenyl)furfurylidene]amino]hydantoin sodium |
| Research Area | Skeletal muscle relaxant that acts by interfering with excitation-contraction coupling in the muscle fiber. DANTROLENE SODIUM is used in spasticity and other neuromuscular abnormalities. Although the mechanism of action is probably not central, dantrolene |
| Molecular Formula | C14H9N4O5 |
| CAS# | 14663-23-1 |
| Purity | >98% |
| SMILES | O=C(N1)N(CC1=O)/N=C/C2=CC=C(C3=CC=C([N+]([O-])=O)C=C3)O2.[Na+] |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSN00354.html |
