Magnesium(II) meso-tetraphenylporphine | MedChemExpress (MCE)
Magnesium meso-tetraphenylporphine is a biochemical reagent that can be used as a biological material or organic compound for life science related research.
| Trivial name | Magnesium(II) meso-tetraphenylporphine |
| Catalog Number | HY-W073189 |
| Research Area | Others |
| CAS# | 14640-21-2 |
| Purity | ≥98.00% |
| SMILES | C12=CC=C3N1[Mg]45[N]6=C(C=CC6=C3C7=CC=CC=C7)C(C8=CC=CC=C8)=C(N95)C=CC9=C(C%10=CC=CC=C%10)C%11=[N]4C(C=C%11)=C2C%12=CC=CC=C%12 |
| PubChem Chemical Structure ID | 6327268 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/magnesium-meso-tetraphenylporphine.html |