Cyanine 3.18 | MedChemExpress (MCE)
Cyanine 3.18 belongs to the cyanine dye series and is a common fluorescent marker for biomolecules that can interact with biomolecules. Cyanine dyes may also bind to double-helical DNA through intercalation and exhibit enhanced fluorescence upon binding.
| Trivial name | Cyanine 3.18 |
| Catalog Number | HY-D1097 |
| CAS# | 146397-17-3 |
| Purity | ≥98.0% |
| SMILES | O=S(C1=CC2=C([N+](CCCCCC(O)=O)=C(/C=C/C=C3N(CCCCCC(O)=O)C4=C(C=C(S(=O)(O)=O)C=C4)C/3(C)C)C2(C)C)C=C1)([O-])=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/cyanine-3-18.html |