Tauroursodeoxycholic acid D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02935 |
| Alternative Name(s) | 2-[(4R)-4-[(1S,2S,5R,7R,9S,10R,11S,14R,15R)-5,9-dihydroxy-2,15-dimethyl(4,4,6,6-2H)4tetracyclo[8.7.0.02,7.011,15]heptadecan-14-yl]pentanamido]ethane-1-sulfonic acid |
| Research Area | Labeled Tauroursodeoxycholic acid, intended for use as an internal standard for the quantification of Tauroursodeoxycholic acid by GC- or LC-mass spectrometry. |
| Molecular Formula | C26H41D4NO6S |
| CAS# | 14605-22-2 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C[C@]1([C@]([H])([C@]2([H])[C@@H](O)C[C@@]3(C([2H])([C@@H](C([2H])(C[C@]3(C)[C@]2(CC1)[H])[2H])O)[2H])[H])CC4)[C@]4([C@@H](CCC(NCCS(=O)(O)=O)=O)C)[H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02935.html |
| Additional Information | NULL |
