Fluphenazine 2HCl
Fluphenazine 2HCl is a inhibitor of D1DR and D2DR. It has been used to deliver fluphenazine to biological systems and also used as an antipsychotic.
| Trivial name | Prolixin |
| Catalog Number | CSN11042 |
| Alternative Name(s) | Prolixin |
| Research Area | Neurological Disease |
| Molecular Formula | C22H28Cl2F3N3OS |
| CAS# | 146-56-5 |
| Purity | ≥99% |
| SMILES | FC(C(C=C1N2CCCN3CCN(CCO)CC3)=CC=C1SC4=C2C=CC=C4)(F)F.[H]Cl.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/fluphenazine-2hcl.html |
