Fluphenazine dihydrochloride
phenothiazine-class D1DR and D2DR inhibitor Neuroscience|Dopamine Receptor
| Catalog Number | B6132-100 |
| Research Area | Neuroscience|Dopamine Receptor |
| Molecular Formula | C22H28Cl2F3N3OS |
| CAS# | 146-56-5 |
| Purity | 98% |
| SMILES | FC(F)(F)C1=CC(N(C2=CC=CC=C2S3)CCCN4CCN(CCO)CC4)=C3C=C1.Cl.Cl |
| Size | 100mg |
| Supplier Page | https://www.apexbt.com/search.php?catalog=B6132 |
