Cycloart-23-Ene-3,25-Diol
Cycloart-23-ene-3,25-diol, a natural product isolated and purified from the herbs of Pongamia pinnata with anti-inflammatory activity and protective activity against streptozotocin induced toxicity, and its treatment can decrease liver malondialdehyde but increase superoxidase dismutase and reduced glutathione.
| Trivial name | Cycloart-23-Ene-3β,25-Diol |
| Catalog Number | CSN14504 |
| Alternative Name(s) | Cycloart-23-Ene-3β,25-Diol |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C30H50O2 |
| CAS# | 14599-48-5 |
| Purity | ≥98% |
| SMILES | CC1(C)[C@@H](O)CC[C@]2(C3)[C@]43CC[C@]5(C)[C@@H]([C@H](C)C/C=C/C(C)(O)C)CC[C@](C)5[C@]4([H])CC[C@@]12[H] |
| Size | 1mg |
| Supplier Page | https://www.csnpharm.com/products/cycloart-23-ene-3,25-diol.html |